C16H21N3 — CID 138711198
7-N-ethenyl-2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methyl-3H-azepine-2,7-diamine (PubChem CID 138711198) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 7-N-ethenyl-2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methyl-3H-azepine-2,7-diamine.
| Compound Name | 7-N-ethenyl-2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methyl-3H-azepine-2,7-diamine |
|---|---|
| PubChem CID | 138711198 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 7-N-ethenyl-2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-methyl-3H-azepine-2,7-diamine |
| SMILES | C=C/C=C(\C=C/C)NC1=NC(NC=C)=C(C)C=CC1 |
| InChI | InChI=1S/C16H21N3/c1-5-9-14(10-6-2)18-15-12-8-11-13(4)16(19-15)17-7-3/h5-11,17H,1,3,12H2,2,4H3,(H,18,19)/b10-6-,14-9+ |
| InChIKey | HTRYXRBPXAEZCU-QGHFCHCFSA-N |
| XLogP | 3.55 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|