C24H37FN2 — CID 138711219
2-(4,4-dimethylpentyl)-N'-ethenyl-2-fluoro-N-[2-[(E)-2-phenylethenyl]cyclopropyl]butane-1,4-diamine (PubChem CID 138711219) has the molecular formula C24H37FN2 and a molecular weight of 372.57 g/mol. Its IUPAC name is 2-(4,4-dimethylpentyl)-N'-ethenyl-2-fluoro-N-[2-[(E)-2-phenylethenyl]cyclopropyl]butane-1,4-diamine.
| Compound Name | 2-(4,4-dimethylpentyl)-N'-ethenyl-2-fluoro-N-[2-[(E)-2-phenylethenyl]cyclopropyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 138711219 |
| Molecular Formula | C24H37FN2 |
| Molecular Weight | 372.57 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 2-(4,4-dimethylpentyl)-N'-ethenyl-2-fluoro-N-[2-[(E)-2-phenylethenyl]cyclopropyl]butane-1,4-diamine |
| SMILES | C=CNCCC(F)(CCCC(C)(C)C)CNC1CC1/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H37FN2/c1-5-26-17-16-24(25,15-9-14-23(2,3)4)19-27-22-18-21(22)13-12-20-10-7-6-8-11-20/h5-8,10-13,21-22,26-27H,1,9,14-19H2,2-4H3/b13-12+ |
| InChIKey | ZAMQQFXQHKJFEK-OUKQBFOZSA-N |
| XLogP | 5.73 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|