C37H50N6O4 — CID 138711251
tert-butyl 4-[5-[[6-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-yl]amino]-1H-indol-3-yl]piperidine-1-carboxylate (PubChem CID 138711251) has the molecular formula C37H50N6O4 and a molecular weight of 642.85 g/mol. Its IUPAC name is tert-butyl 4-[5-[[6-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-yl]amino]-1H-indol-3-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-[[6-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-yl]amino]-1H-indol-3-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 138711251 |
| Molecular Formula | C37H50N6O4 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | tert-butyl 4-[5-[[6-[ethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-9-methyl-5,6,7,8-tetrahydropyrido[2,3-b]indol-2-yl]amino]-1H-indol-3-yl]piperidine-1-carboxylate |
| SMILES | CCN(C(=O)OC(C)(C)C)C1CCc2c(c3ccc(Nc4ccc5[nH]cc(C6CCN(C(=O)OC(C)(C)C)CC6)c5c4)nc3n2C)C1 |
| InChI | InChI=1S/C37H50N6O4/c1-9-43(35(45)47-37(5,6)7)25-11-14-31-28(21-25)26-12-15-32(40-33(26)41(31)8)39-24-10-13-30-27(20-24)29(22-38-30)23-16-18-42(19-17-23)34(44)46-36(2,3)4/h10,12-13,15,20,22-23,25,38H,9,11,14,16-19,21H2,1-8H3,(H,39,40) |
| InChIKey | ZQQHYFMQMWHQSS-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |