C23H34N2O — CID 138711292
5-[[4-[[2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]amino]pent-1-en-2-ol (PubChem CID 138711292) has the molecular formula C23H34N2O and a molecular weight of 354.54 g/mol. Its IUPAC name is 5-[[4-[[2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]amino]pent-1-en-2-ol.
| Compound Name | 5-[[4-[[2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]amino]pent-1-en-2-ol |
|---|---|
| PubChem CID | 138711292 |
| Molecular Formula | C23H34N2O |
| Molecular Weight | 354.54 g/mol |
| Exact Mass | 354.27 |
| IUPAC Name | 5-[[4-[[2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]amino]pent-1-en-2-ol |
| SMILES | C=C(O)CCCNC1CCC(NC2CC2/C(C)=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C23H34N2O/c1-17(15-19-8-4-3-5-9-19)22-16-23(22)25-21-12-10-20(11-13-21)24-14-6-7-18(2)26/h3-5,8-9,15,20-26H,2,6-7,10-14,16H2,1H3/b17-15+ |
| InChIKey | GKHTWHKAOGHCQK-BMRADRMJSA-N |
| XLogP | 4.82 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|