C9H15NO2 — CID 138711316
(2E,4Z)-1,6-dimethoxyhepta-2,4,6-trien-3-amine (PubChem CID 138711316) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (2E,4Z)-1,6-dimethoxyhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-1,6-dimethoxyhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 138711316 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (2E,4Z)-1,6-dimethoxyhepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(N)=C/COC)OC |
| InChI | InChI=1S/C9H15NO2/c1-8(12-3)4-5-9(10)6-7-11-2/h4-6H,1,7,10H2,2-3H3/b5-4-,9-6+ |
| InChIKey | RDQOVIUXCASJCR-KMOPYBJPSA-N |
| XLogP | 1.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|