C22H38FN5 — CID 138711447
(1Z,4Z)-6-ethylimino-N'-[2-(4-fluoropiperidin-4-yl)ethyl]-3-methylidene-2-piperidin-4-ylhepta-1,4-diene-1,7-diamine (PubChem CID 138711447) has the molecular formula C22H38FN5 and a molecular weight of 391.58 g/mol. Its IUPAC name is (1Z,4Z)-6-ethylimino-N'-[2-(4-fluoropiperidin-4-yl)ethyl]-3-methylidene-2-piperidin-4-ylhepta-1,4-diene-1,7-diamine.
| Compound Name | (1Z,4Z)-6-ethylimino-N'-[2-(4-fluoropiperidin-4-yl)ethyl]-3-methylidene-2-piperidin-4-ylhepta-1,4-diene-1,7-diamine |
|---|---|
| PubChem CID | 138711447 |
| Molecular Formula | C22H38FN5 |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | (1Z,4Z)-6-ethylimino-N'-[2-(4-fluoropiperidin-4-yl)ethyl]-3-methylidene-2-piperidin-4-ylhepta-1,4-diene-1,7-diamine |
| SMILES | C=C(/C=C\C(CNCCC1(F)CCNCC1)=N\CC)/C(=C\N)C1CCNCC1 |
| InChI | InChI=1S/C22H38FN5/c1-3-28-20(17-27-15-10-22(23)8-13-26-14-9-22)5-4-18(2)21(16-24)19-6-11-25-12-7-19/h4-5,16,19,25-27H,2-3,6-15,17,24H2,1H3/b5-4-,21-16+,28-20- |
| InChIKey | AIJCSQICWSMFED-IQLHZEQTSA-N |
| XLogP | 2.47 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|