C14H23N3 — CID 138711448
(2E)-1-[2-[(1Z,3E)-3-ethylhexa-1,3,5-trienyl]hydrazinyl]-3-methylpenta-2,4-dien-1-amine (PubChem CID 138711448) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is (2E)-1-[2-[(1Z,3E)-3-ethylhexa-1,3,5-trienyl]hydrazinyl]-3-methylpenta-2,4-dien-1-amine.
| Compound Name | (2E)-1-[2-[(1Z,3E)-3-ethylhexa-1,3,5-trienyl]hydrazinyl]-3-methylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 138711448 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | (2E)-1-[2-[(1Z,3E)-3-ethylhexa-1,3,5-trienyl]hydrazinyl]-3-methylpenta-2,4-dien-1-amine |
| SMILES | C=C/C=C(/C=C\NNC(N)/C=C(\C)C=C)CC |
| InChI | InChI=1S/C14H23N3/c1-5-8-13(7-3)9-10-16-17-14(15)11-12(4)6-2/h5-6,8-11,14,16-17H,1-2,7,15H2,3-4H3/b10-9-,12-11+,13-8+ |
| InChIKey | CSDQGKRASZPYBC-OPDSHJOHSA-N |
| XLogP | 2.53 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|