About 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate
2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate (PubChem CID 138711905) has the molecular formula C30H58O2
and a molecular weight of 450.79 g/mol. Its IUPAC name is 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate.
Molecular Properties
| Compound Name | 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate |
| PubChem CID | 138711905 |
| Molecular Formula | C30H58O2 |
| Molecular Weight | 450.79 g/mol |
| Exact Mass | 450.44 |
| IUPAC Name | 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate |
| SMILES | C=C(CCC(CCC)CCCCC)C(C)CCC(C)C(=O)OCC(CCC)CCCCC |
| InChI | InChI=1S/C30H58O2/c1-8-12-14-18-28(16-10-3)23-22-26(6)25(5)20-21-27(7)30(31)32-24-29(17-11-4)19-15-13-9-2/h25,27-29H,6,8-24H2,1-5,7H3 |
| InChIKey | LBDXUTOVFRCJGY-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.79 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate?
The IUPAC name of 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate (CID 138711905) is 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate.
What is the SMILES notation for 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate?
The canonical SMILES for 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate is C=C(CCC(CCC)CCCCC)C(C)CCC(C)C(=O)OCC(CCC)CCCCC.
What is the InChIKey of 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate?
The InChIKey is LBDXUTOVFRCJGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H58O2/c1-8-12-14-18-28(16-10-3)23-22-26(6)25(5)20-21-27(7)30(31)32-24-29(17-11-4)19-15-13-9-2/h25,27-29H,6,8-24H2,1-5,7H3.
What are the key properties of 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate?
2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate has a molecular weight of 450.79 g/mol, XLogP of 9.91, 22 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylheptyl 2,5-dimethyl-6-methylidene-9-propyltetradecanoate is sourced from PubChem (CID 138711905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).