C11H18N2O — CID 138711912
(1E,3E,5Z)-1-morpholin-4-ylhepta-1,3,5-trien-4-amine (PubChem CID 138711912) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (1E,3E,5Z)-1-morpholin-4-ylhepta-1,3,5-trien-4-amine.
| Compound Name | (1E,3E,5Z)-1-morpholin-4-ylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 138711912 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (1E,3E,5Z)-1-morpholin-4-ylhepta-1,3,5-trien-4-amine |
| SMILES | C/C=C\C(N)=C/C=C/N1CCOCC1 |
| InChI | InChI=1S/C11H18N2O/c1-2-4-11(12)5-3-6-13-7-9-14-10-8-13/h2-6H,7-10,12H2,1H3/b4-2-,6-3+,11-5+ |
| InChIKey | MMLMRZROYKFHJU-UYPZKSHPSA-N |
| XLogP | 1.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|