C20H22F3NO6S2 — CID 138711996
5-methylsulfonyl-2-[4-methyl-4-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-1-yn-4-yl]sulfonyloxan-2-yl]pyridin-3-ol (PubChem CID 138711996) has the molecular formula C20H22F3NO6S2 and a molecular weight of 493.53 g/mol. Its IUPAC name is 5-methylsulfonyl-2-[4-methyl-4-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-1-yn-4-yl]sulfonyloxan-2-yl]pyridin-3-ol.
| Compound Name | 5-methylsulfonyl-2-[4-methyl-4-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-1-yn-4-yl]sulfonyloxan-2-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 138711996 |
| Molecular Formula | C20H22F3NO6S2 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | 5-methylsulfonyl-2-[4-methyl-4-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-3,5-dien-1-yn-4-yl]sulfonyloxan-2-yl]pyridin-3-ol |
| SMILES | C#C/C=C(\C=C(/C)C(F)(F)F)S(=O)(=O)C1(C)CCOC(c2ncc(S(C)(=O)=O)cc2O)C1 |
| InChI | InChI=1S/C20H22F3NO6S2/c1-5-6-14(9-13(2)20(21,22)23)32(28,29)19(3)7-8-30-17(11-19)18-16(25)10-15(12-24-18)31(4,26)27/h1,6,9-10,12,17,25H,7-8,11H2,2-4H3/b13-9+,14-6+ |
| InChIKey | ZSKYYTUMNBNYNC-WSPXSRFVSA-N |
| XLogP | 3.24 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|