C34H27FN2O2S — CID 138712051
2-butyl-6-[[2-(6-fluoro-4-naphthalen-1-yl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]benzene-1,4-diol (PubChem CID 138712051) has the molecular formula C34H27FN2O2S and a molecular weight of 546.67 g/mol. Its IUPAC name is 2-butyl-6-[[2-(6-fluoro-4-naphthalen-1-yl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]benzene-1,4-diol.
| Compound Name | 2-butyl-6-[[2-(6-fluoro-4-naphthalen-1-yl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 138712051 |
| Molecular Formula | C34H27FN2O2S |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 2-butyl-6-[[2-(6-fluoro-4-naphthalen-1-yl-1,3-benzothiazol-2-yl)phenyl]iminomethyl]benzene-1,4-diol |
| SMILES | CCCCc1cc(O)cc(/C=N/c2ccccc2-c2nc3c(-c4cccc5ccccc45)cc(F)cc3s2)c1O |
| InChI | InChI=1S/C34H27FN2O2S/c1-2-3-9-22-16-25(38)17-23(33(22)39)20-36-30-15-7-6-13-28(30)34-37-32-29(18-24(35)19-31(32)40-34)27-14-8-11-21-10-4-5-12-26(21)27/h4-8,10-20,38-39H,2-3,9H2,1H3/b36-20+ |
| InChIKey | KDVTWTSJAGMBIC-ZSNJKBEMSA-N |
| XLogP | 9.43 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|