C19H25N3O — CID 138712790
(3S)-3-N,5-N-dibenzyloxane-3,4,5-triamine (PubChem CID 138712790) has the molecular formula C19H25N3O and a molecular weight of 311.43 g/mol. Its IUPAC name is (3S)-3-N,5-N-dibenzyloxane-3,4,5-triamine.
| Compound Name | (3S)-3-N,5-N-dibenzyloxane-3,4,5-triamine |
|---|---|
| PubChem CID | 138712790 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | (3S)-3-N,5-N-dibenzyloxane-3,4,5-triamine |
| SMILES | NC1C(NCc2ccccc2)COC[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C19H25N3O/c20-19-17(21-11-15-7-3-1-4-8-15)13-23-14-18(19)22-12-16-9-5-2-6-10-16/h1-10,17-19,21-22H,11-14,20H2/t17-,18?,19?/m1/s1 |
| InChIKey | DMZJTYFTVGWJOA-LMDPOFIKSA-N |
| XLogP | 1.66 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |