About 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol
2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol (PubChem CID 138713772) has the molecular formula C10H7FN2OS
and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol.
Molecular Properties
| Compound Name | 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol |
| PubChem CID | 138713772 |
| Molecular Formula | C10H7FN2OS |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol |
| SMILES | Nc1nc2c(O)cc(C#CCF)cc2s1 |
| InChI | InChI=1S/C10H7FN2OS/c11-3-1-2-6-4-7(14)9-8(5-6)15-10(12)13-9/h4-5,14H,3H2,(H2,12,13) |
| InChIKey | PGYCBPHBQCSJCP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol?
The IUPAC name of 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol (CID 138713772) is 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol.
What is the SMILES notation for 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol?
The canonical SMILES for 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol is Nc1nc2c(O)cc(C#CCF)cc2s1.
What is the InChIKey of 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol?
The InChIKey is PGYCBPHBQCSJCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2OS/c11-3-1-2-6-4-7(14)9-8(5-6)15-10(12)13-9/h4-5,14H,3H2,(H2,12,13).
What are the key properties of 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol?
2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol has a molecular weight of 222.24 g/mol, XLogP of 1.91, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(3-fluoroprop-1-ynyl)-1,3-benzothiazol-4-ol is sourced from PubChem (CID 138713772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).