C26H30N6O3 — CID 138713832
(E)-1-[3-[8-amino-1-[2-(3,5-dimethoxyphenyl)ethynyl]imidazo[1,5-a]pyrazin-3-yl]azetidin-1-yl]-4-(propan-2-ylamino)but-2-en-1-one (PubChem CID 138713832) has the molecular formula C26H30N6O3 and a molecular weight of 474.57 g/mol. Its IUPAC name is (E)-1-[3-[8-amino-1-[2-(3,5-dimethoxyphenyl)ethynyl]imidazo[1,5-a]pyrazin-3-yl]azetidin-1-yl]-4-(propan-2-ylamino)but-2-en-1-one.
| Compound Name | (E)-1-[3-[8-amino-1-[2-(3,5-dimethoxyphenyl)ethynyl]imidazo[1,5-a]pyrazin-3-yl]azetidin-1-yl]-4-(propan-2-ylamino)but-2-en-1-one |
|---|---|
| PubChem CID | 138713832 |
| Molecular Formula | C26H30N6O3 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | (E)-1-[3-[8-amino-1-[2-(3,5-dimethoxyphenyl)ethynyl]imidazo[1,5-a]pyrazin-3-yl]azetidin-1-yl]-4-(propan-2-ylamino)but-2-en-1-one |
| SMILES | COc1cc(C#Cc2nc(C3CN(C(=O)/C=C/CNC(C)C)C3)n3ccnc(N)c23)cc(OC)c1 |
| InChI | InChI=1S/C26H30N6O3/c1-17(2)28-9-5-6-23(33)31-15-19(16-31)26-30-22(24-25(27)29-10-11-32(24)26)8-7-18-12-20(34-3)14-21(13-18)35-4/h5-6,10-14,17,19,28H,9,15-16H2,1-4H3,(H2,27,29)/b6-5+ |
| InChIKey | FJGOKOLQDKWXKI-AATRIKPKSA-N |
| XLogP | 2.21 |
| TPSA | 107.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|