About 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol
2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol (PubChem CID 138713902) has the molecular formula C11H9FN2OS
and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol.
Molecular Properties
| Compound Name | 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol |
| PubChem CID | 138713902 |
| Molecular Formula | C11H9FN2OS |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol |
| SMILES | Nc1nc2c(O)cc(C#CCCF)cc2s1 |
| InChI | InChI=1S/C11H9FN2OS/c12-4-2-1-3-7-5-8(15)10-9(6-7)16-11(13)14-10/h5-6,15H,2,4H2,(H2,13,14) |
| InChIKey | KBVBLAQXIPTVCN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol?
The IUPAC name of 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol (CID 138713902) is 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol.
What is the SMILES notation for 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol?
The canonical SMILES for 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol is Nc1nc2c(O)cc(C#CCCF)cc2s1.
What is the InChIKey of 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol?
The InChIKey is KBVBLAQXIPTVCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2OS/c12-4-2-1-3-7-5-8(15)10-9(6-7)16-11(13)14-10/h5-6,15H,2,4H2,(H2,13,14).
What are the key properties of 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol?
2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol has a molecular weight of 236.27 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-(4-fluorobut-1-ynyl)-1,3-benzothiazol-4-ol is sourced from PubChem (CID 138713902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).