About (2R)-3-N-methylbutane-2,3-diamine
(2R)-3-N-methylbutane-2,3-diamine (PubChem CID 138713984) has the molecular formula C5H14N2
and a molecular weight of 102.18 g/mol. Its IUPAC name is (2R)-3-N-methylbutane-2,3-diamine.
Molecular Properties
| Compound Name | (2R)-3-N-methylbutane-2,3-diamine |
| PubChem CID | 138713984 |
| Molecular Formula | C5H14N2 |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | (2R)-3-N-methylbutane-2,3-diamine |
| SMILES | CNC(C)[C@@H](C)N |
| InChI | InChI=1S/C5H14N2/c1-4(6)5(2)7-3/h4-5,7H,6H2,1-3H3/t4-,5?/m1/s1 |
| InChIKey | ZAFKWADGQSJLBQ-CNZKWPKMSA-N |
| XLogP | -0.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-3-N-methylbutane-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-N-methylbutane-2,3-diamine?
The IUPAC name of (2R)-3-N-methylbutane-2,3-diamine (CID 138713984) is (2R)-3-N-methylbutane-2,3-diamine.
What is the SMILES notation for (2R)-3-N-methylbutane-2,3-diamine?
The canonical SMILES for (2R)-3-N-methylbutane-2,3-diamine is CNC(C)[C@@H](C)N.
What is the InChIKey of (2R)-3-N-methylbutane-2,3-diamine?
The InChIKey is ZAFKWADGQSJLBQ-CNZKWPKMSA-N. The full InChI is InChI=1S/C5H14N2/c1-4(6)5(2)7-3/h4-5,7H,6H2,1-3H3/t4-,5?/m1/s1.
What are the key properties of (2R)-3-N-methylbutane-2,3-diamine?
(2R)-3-N-methylbutane-2,3-diamine has a molecular weight of 102.18 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-N-methylbutane-2,3-diamine is sourced from PubChem (CID 138713984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).