About 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol
2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol (PubChem CID 138714038) has the molecular formula C11H14N2OS2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol.
Molecular Properties
| Compound Name | 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol |
| PubChem CID | 138714038 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol |
| SMILES | CC(C)(C)Sc1cc(O)c2nc(N)sc2c1 |
| InChI | InChI=1S/C11H14N2OS2/c1-11(2,3)16-6-4-7(14)9-8(5-6)15-10(12)13-9/h4-5,14H,1-3H3,(H2,12,13) |
| InChIKey | KNTXOMQIKQRYHD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol?
The IUPAC name of 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol (CID 138714038) is 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol.
What is the SMILES notation for 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol?
The canonical SMILES for 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol is CC(C)(C)Sc1cc(O)c2nc(N)sc2c1.
What is the InChIKey of 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol?
The InChIKey is KNTXOMQIKQRYHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS2/c1-11(2,3)16-6-4-7(14)9-8(5-6)15-10(12)13-9/h4-5,14H,1-3H3,(H2,12,13).
What are the key properties of 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol?
2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol has a molecular weight of 254.38 g/mol, XLogP of 3.47, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6-tert-butylsulfanyl-1,3-benzothiazol-4-ol is sourced from PubChem (CID 138714038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).