C22H20F5N3O3 — CID 138714327
N-[(2E,4E,6E)-5-fluoro-6-methoxyimino-2-methylhexa-2,4-dienyl]-3-(5-fluoro-2-pyridinyl)-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide (PubChem CID 138714327) has the molecular formula C22H20F5N3O3 and a molecular weight of 469.41 g/mol. Its IUPAC name is N-[(2E,4E,6E)-5-fluoro-6-methoxyimino-2-methylhexa-2,4-dienyl]-3-(5-fluoro-2-pyridinyl)-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide.
| Compound Name | N-[(2E,4E,6E)-5-fluoro-6-methoxyimino-2-methylhexa-2,4-dienyl]-3-(5-fluoro-2-pyridinyl)-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 138714327 |
| Molecular Formula | C22H20F5N3O3 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-[(2E,4E,6E)-5-fluoro-6-methoxyimino-2-methylhexa-2,4-dienyl]-3-(5-fluoro-2-pyridinyl)-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide |
| SMILES | CO/N=C/C(F)=C\C=C(/C)CNC(=O)c1cc(-c2ccc(F)cn2)cc(C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F5N3O3/c1-13(3-4-18(24)12-30-33-2)10-29-21(32)16-8-14(19-6-5-17(23)11-28-19)7-15(9-16)20(31)22(25,26)27/h3-9,11-12,20,31H,10H2,1-2H3,(H,29,32)/b13-3+,18-4+,30-12+ |
| InChIKey | SLBVOWQEKXXWEP-CEIJGNFQSA-N |
| XLogP | 4.65 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|