C23H22F5N3O3 — CID 138714489
N-[(2Z,4E,6E)-3,5-difluoro-6-methoxyimino-2-methylhexa-2,4-dienyl]-3-(5-methyl-2-pyridinyl)-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide (PubChem CID 138714489) has the molecular formula C23H22F5N3O3 and a molecular weight of 483.44 g/mol. Its IUPAC name is N-[(2Z,4E,6E)-3,5-difluoro-6-methoxyimino-2-methylhexa-2,4-dienyl]-3-(5-methyl-2-pyridinyl)-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide.
| Compound Name | N-[(2Z,4E,6E)-3,5-difluoro-6-methoxyimino-2-methylhexa-2,4-dienyl]-3-(5-methyl-2-pyridinyl)-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 138714489 |
| Molecular Formula | C23H22F5N3O3 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[(2Z,4E,6E)-3,5-difluoro-6-methoxyimino-2-methylhexa-2,4-dienyl]-3-(5-methyl-2-pyridinyl)-5-(2,2,2-trifluoro-1-hydroxyethyl)benzamide |
| SMILES | CO/N=C/C(F)=C\C(F)=C(/C)CNC(=O)c1cc(-c2ccc(C)cn2)cc(C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C23H22F5N3O3/c1-13-4-5-20(29-10-13)15-6-16(21(32)23(26,27)28)8-17(7-15)22(33)30-11-14(2)19(25)9-18(24)12-31-34-3/h4-10,12,21,32H,11H2,1-3H3,(H,30,33)/b18-9+,19-14-,31-12+ |
| InChIKey | KQEMMAVGXMEZQX-UYDZLJTASA-N |
| XLogP | 5.11 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|