C12H18F2N2OS — CID 138714770
(R)-N-[3-(4-aminopentan-2-yl)phenyl]-1,1-difluoromethanesulfinamide (PubChem CID 138714770) has the molecular formula C12H18F2N2OS and a molecular weight of 276.35 g/mol. Its IUPAC name is (R)-N-[3-(4-aminopentan-2-yl)phenyl]-1,1-difluoromethanesulfinamide.
| Compound Name | (R)-N-[3-(4-aminopentan-2-yl)phenyl]-1,1-difluoromethanesulfinamide |
|---|---|
| PubChem CID | 138714770 |
| Molecular Formula | C12H18F2N2OS |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (R)-N-[3-(4-aminopentan-2-yl)phenyl]-1,1-difluoromethanesulfinamide |
| SMILES | CC(N)CC(C)c1cccc(N[S@](=O)C(F)F)c1 |
| InChI | InChI=1S/C12H18F2N2OS/c1-8(6-9(2)15)10-4-3-5-11(7-10)16-18(17)12(13)14/h3-5,7-9,12,16H,6,15H2,1-2H3/t8?,9?,18-/m1/s1 |
| InChIKey | GSDPLOQDYUOFCW-GBKQCDHHSA-N |
| XLogP | 2.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |