C15H19N3 — CID 138714824
(2E,4Z)-N-[[[(2E,4Z)-hepta-2,4,6-trienylidene]amino]methylidene]-2-methylhexa-2,4-dienimidamide (PubChem CID 138714824) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is (2E,4Z)-N-[[[(2E,4Z)-hepta-2,4,6-trienylidene]amino]methylidene]-2-methylhexa-2,4-dienimidamide.
| Compound Name | (2E,4Z)-N-[[[(2E,4Z)-hepta-2,4,6-trienylidene]amino]methylidene]-2-methylhexa-2,4-dienimidamide |
|---|---|
| PubChem CID | 138714824 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (2E,4Z)-N-[[[(2E,4Z)-hepta-2,4,6-trienylidene]amino]methylidene]-2-methylhexa-2,4-dienimidamide |
| SMILES | [H]/N=C(\N=C\N=C\C=C\C=C/C=C)C(/C)=C/C=C\C |
| InChI | InChI=1S/C15H19N3/c1-4-6-8-9-10-12-17-13-18-15(16)14(3)11-7-5-2/h4-13,16H,1H2,2-3H3/b7-5-,8-6-,10-9+,14-11+,16-15-,17-12+,18-13+ |
| InChIKey | LMSSZJVBBFKLPI-YPBPPEGVSA-N |
| XLogP | 3.88 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|