C16H21FO2 — CID 138714897
2-[[(2E,4Z)-4-cyclopropyloxyhexa-2,4-dienoxy]methyl]-3-fluorocyclohexa-1,3-diene (PubChem CID 138714897) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is 2-[[(2E,4Z)-4-cyclopropyloxyhexa-2,4-dienoxy]methyl]-3-fluorocyclohexa-1,3-diene.
| Compound Name | 2-[[(2E,4Z)-4-cyclopropyloxyhexa-2,4-dienoxy]methyl]-3-fluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 138714897 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-[[(2E,4Z)-4-cyclopropyloxyhexa-2,4-dienoxy]methyl]-3-fluorocyclohexa-1,3-diene |
| SMILES | C/C=C(/C=C/COCC1=CCCC=C1F)OC1CC1 |
| InChI | InChI=1S/C16H21FO2/c1-2-14(19-15-9-10-15)7-5-11-18-12-13-6-3-4-8-16(13)17/h2,5-8,15H,3-4,9-12H2,1H3/b7-5+,14-2- |
| InChIKey | KCYHEAGEWGMNMM-HVHHZBGASA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|