C16H25FN2 — CID 138715345
4-N-[2-[(1Z,3Z,5Z)-1-fluorohepta-1,3,5-trien-2-yl]cyclopropyl]cyclohexane-1,4-diamine (PubChem CID 138715345) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is 4-N-[2-[(1Z,3Z,5Z)-1-fluorohepta-1,3,5-trien-2-yl]cyclopropyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[2-[(1Z,3Z,5Z)-1-fluorohepta-1,3,5-trien-2-yl]cyclopropyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 138715345 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 4-N-[2-[(1Z,3Z,5Z)-1-fluorohepta-1,3,5-trien-2-yl]cyclopropyl]cyclohexane-1,4-diamine |
| SMILES | C/C=C\C=C/C(=C/F)C1CC1NC1CCC(N)CC1 |
| InChI | InChI=1S/C16H25FN2/c1-2-3-4-5-12(11-17)15-10-16(15)19-14-8-6-13(18)7-9-14/h2-5,11,13-16,19H,6-10,18H2,1H3/b3-2-,5-4-,12-11- |
| InChIKey | OUHVHLRJDBVTJS-SBPYLWTKSA-N |
| XLogP | 3.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|