About 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine
3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine (PubChem CID 138716030) has the molecular formula C16H23NO
and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine |
| PubChem CID | 138716030 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)NCCCOc1cccc2c1=CCCC=2 |
| InChI | InChI=1S/C16H23NO/c1-13(2)17-11-6-12-18-16-10-5-8-14-7-3-4-9-15(14)16/h5,7-10,13,17H,3-4,6,11-12H2,1-2H3 |
| InChIKey | QBSQVQYKYRQTFQ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine?
The IUPAC name of 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine (CID 138716030) is 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine.
What is the SMILES notation for 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine?
The canonical SMILES for 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine is CC(C)NCCCOc1cccc2c1=CCCC=2.
What is the InChIKey of 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine?
The InChIKey is QBSQVQYKYRQTFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO/c1-13(2)17-11-6-12-18-16-10-5-8-14-7-3-4-9-15(14)16/h5,7-10,13,17H,3-4,6,11-12H2,1-2H3.
What are the key properties of 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine?
3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine has a molecular weight of 245.37 g/mol, XLogP of 1.81, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-dihydronaphthalen-1-yloxy)-N-propan-2-ylpropan-1-amine is sourced from PubChem (CID 138716030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).