About 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane
4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane (PubChem CID 138716067) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane.
Molecular Properties
| Compound Name | 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane |
| PubChem CID | 138716067 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane |
| SMILES | C#CC1=CCC(CN2CCCOCC2)C=C1 |
| InChI | InChI=1S/C14H19NO/c1-2-13-4-6-14(7-5-13)12-15-8-3-10-16-11-9-15/h1,4-6,14H,3,7-12H2 |
| InChIKey | MPZJHJMDCJDVKF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane?
The IUPAC name of 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane (CID 138716067) is 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane.
What is the SMILES notation for 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane?
The canonical SMILES for 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane is C#CC1=CCC(CN2CCCOCC2)C=C1.
What is the InChIKey of 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane?
The InChIKey is MPZJHJMDCJDVKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO/c1-2-13-4-6-14(7-5-13)12-15-8-3-10-16-11-9-15/h1,4-6,14H,3,7-12H2.
What are the key properties of 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane?
4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane has a molecular weight of 217.31 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-ethynylcyclohexa-2,4-dien-1-yl)methyl]-1,4-oxazepane is sourced from PubChem (CID 138716067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).