C15H22N2O3 — CID 138716146
(2E,3Z)-N-(1-amino-1,3-dioxobutan-2-yl)-N,5-dimethyl-2-propylidenehexa-3,5-dienamide (PubChem CID 138716146) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (2E,3Z)-N-(1-amino-1,3-dioxobutan-2-yl)-N,5-dimethyl-2-propylidenehexa-3,5-dienamide.
| Compound Name | (2E,3Z)-N-(1-amino-1,3-dioxobutan-2-yl)-N,5-dimethyl-2-propylidenehexa-3,5-dienamide |
|---|---|
| PubChem CID | 138716146 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (2E,3Z)-N-(1-amino-1,3-dioxobutan-2-yl)-N,5-dimethyl-2-propylidenehexa-3,5-dienamide |
| SMILES | C=C(C)/C=C\C(=C/CC)C(=O)N(C)C(C(C)=O)C(N)=O |
| InChI | InChI=1S/C15H22N2O3/c1-6-7-12(9-8-10(2)3)15(20)17(5)13(11(4)18)14(16)19/h7-9,13H,2,6H2,1,3-5H3,(H2,16,19)/b9-8-,12-7+ |
| InChIKey | FCKVXZSPTZTELM-ZHCAKQDLSA-N |
| XLogP | 1.36 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|