About N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine
N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine (PubChem CID 138716181) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine |
| PubChem CID | 138716181 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine |
| SMILES | C=N/C(=C\CCC)CN(C)CCNCC |
| InChI | InChI=1S/C12H25N3/c1-5-7-8-12(13-3)11-15(4)10-9-14-6-2/h8,14H,3,5-7,9-11H2,1-2,4H3/b12-8- |
| InChIKey | WFJYTQCKYSGGKY-WQLSENKSSA-N |
| XLogP | 1.91 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine?
The IUPAC name of N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine (CID 138716181) is N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine.
What is the SMILES notation for N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine?
The canonical SMILES for N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine is C=N/C(=C\CCC)CN(C)CCNCC.
What is the InChIKey of N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine?
The InChIKey is WFJYTQCKYSGGKY-WQLSENKSSA-N. The full InChI is InChI=1S/C12H25N3/c1-5-7-8-12(13-3)11-15(4)10-9-14-6-2/h8,14H,3,5-7,9-11H2,1-2,4H3/b12-8-.
What are the key properties of N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine?
N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine has a molecular weight of 211.35 g/mol, XLogP of 1.91, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-methyl-N'-[(Z)-2-(methylideneamino)hex-2-enyl]ethane-1,2-diamine is sourced from PubChem (CID 138716181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).