About 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid
2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid (PubChem CID 138716275) has the molecular formula C17H21F4NO2
and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid |
| PubChem CID | 138716275 |
| Molecular Formula | C17H21F4NO2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid |
| SMILES | CCC(CC)(C(=O)O)[C@H]1CC[C@@H](c2cc(F)cc(C(F)(F)F)c2)N1 |
| InChI | InChI=1S/C17H21F4NO2/c1-3-16(4-2,15(23)24)14-6-5-13(22-14)10-7-11(17(19,20)21)9-12(18)8-10/h7-9,13-14,22H,3-6H2,1-2H3,(H,23,24)/t13-,14+/m0/s1 |
| InChIKey | MHDIZIFGAAAXTG-UONOGXRCSA-N |
| XLogP | 4.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid?
The IUPAC name of 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid (CID 138716275) is 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid.
What is the SMILES notation for 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid?
The canonical SMILES for 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid is CCC(CC)(C(=O)O)[C@H]1CC[C@@H](c2cc(F)cc(C(F)(F)F)c2)N1.
What is the InChIKey of 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid?
The InChIKey is MHDIZIFGAAAXTG-UONOGXRCSA-N. The full InChI is InChI=1S/C17H21F4NO2/c1-3-16(4-2,15(23)24)14-6-5-13(22-14)10-7-11(17(19,20)21)9-12(18)8-10/h7-9,13-14,22H,3-6H2,1-2H3,(H,23,24)/t13-,14+/m0/s1.
What are the key properties of 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid?
2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid has a molecular weight of 347.35 g/mol, XLogP of 4.53, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-[(2R,5S)-5-[3-fluoro-5-(trifluoromethyl)phenyl]pyrrolidin-2-yl]butanoic acid is sourced from PubChem (CID 138716275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).