C30H38N2O3 — CID 138716780
(4R,5R,11S,12R,16R)-6-(dimethylamino)-15-isoquinolin-7-yl-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-diene-4,5,11-triol (PubChem CID 138716780) has the molecular formula C30H38N2O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is (4R,5R,11S,12R,16R)-6-(dimethylamino)-15-isoquinolin-7-yl-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-diene-4,5,11-triol.
| Compound Name | (4R,5R,11S,12R,16R)-6-(dimethylamino)-15-isoquinolin-7-yl-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-diene-4,5,11-triol |
|---|---|
| PubChem CID | 138716780 |
| Molecular Formula | C30H38N2O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | (4R,5R,11S,12R,16R)-6-(dimethylamino)-15-isoquinolin-7-yl-16-methyltetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-diene-4,5,11-triol |
| SMILES | CN(C)C1CC2CC[C@@]3(O)C(=CC[C@]4(C)C(c5ccc6ccncc6c5)CC[C@@H]34)C=C2[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C30H38N2O3/c1-29-11-9-22-16-23-19(15-25(32(2)3)28(34)27(23)33)8-12-30(22,35)26(29)7-6-24(29)20-5-4-18-10-13-31-17-21(18)14-20/h4-5,9-10,13-14,16-17,19,24-28,33-35H,6-8,11-12,15H2,1-3H3/t19?,24?,25?,26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | IXXOYDZRNWYMKB-WMCFUZKYSA-N |
| XLogP | 4.19 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |