About 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one
4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one (PubChem CID 138717020) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one |
| PubChem CID | 138717020 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one |
| SMILES | C=C/C=C\c1[nH]c(=O)oc1C |
| InChI | InChI=1S/C8H9NO2/c1-3-4-5-7-6(2)11-8(10)9-7/h3-5H,1H2,2H3,(H,9,10)/b5-4- |
| InChIKey | XZIQFXLMYJZKLK-PLNGDYQASA-N |
| XLogP | 1.48 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one?
The IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one (CID 138717020) is 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one.
What is the SMILES notation for 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one?
The canonical SMILES for 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one is C=C/C=C\c1[nH]c(=O)oc1C.
What is the InChIKey of 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one?
The InChIKey is XZIQFXLMYJZKLK-PLNGDYQASA-N. The full InChI is InChI=1S/C8H9NO2/c1-3-4-5-7-6(2)11-8(10)9-7/h3-5H,1H2,2H3,(H,9,10)/b5-4-.
What are the key properties of 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one?
4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one has a molecular weight of 151.16 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z)-buta-1,3-dienyl]-5-methyl-3H-1,3-oxazol-2-one is sourced from PubChem (CID 138717020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).