About 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one
4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one (PubChem CID 138717346) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one.
Molecular Properties
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one |
| PubChem CID | 138717346 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one |
| SMILES | C=C(NC(C(C)=O)C(C)(C)C1=CCCC=C1)C(C)C |
| InChI | InChI=1S/C17H27NO/c1-12(2)13(3)18-16(14(4)19)17(5,6)15-10-8-7-9-11-15/h8,10-12,16,18H,3,7,9H2,1-2,4-6H3 |
| InChIKey | RUBYMARAGOXZOG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one?
The IUPAC name of 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one (CID 138717346) is 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one.
What is the SMILES notation for 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one?
The canonical SMILES for 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one is C=C(NC(C(C)=O)C(C)(C)C1=CCCC=C1)C(C)C.
What is the InChIKey of 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one?
The InChIKey is RUBYMARAGOXZOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27NO/c1-12(2)13(3)18-16(14(4)19)17(5,6)15-10-8-7-9-11-15/h8,10-12,16,18H,3,7,9H2,1-2,4-6H3.
What are the key properties of 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one?
4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one has a molecular weight of 261.41 g/mol, XLogP of 4.01, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexa-1,5-dien-1-yl-4-methyl-3-(3-methylbut-1-en-2-ylamino)pentan-2-one is sourced from PubChem (CID 138717346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).