About (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol
(2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol (PubChem CID 138717575) has the molecular formula C7H14O5
and a molecular weight of 178.18 g/mol. Its IUPAC name is (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol.
Molecular Properties
| Compound Name | (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol |
| PubChem CID | 138717575 |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol |
| SMILES | CC[C@H](O)C1O[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C7H14O5/c1-2-3(8)6-4(9)5(10)7(11)12-6/h3-11H,2H2,1H3/t3-,4?,5?,6?,7+/m0/s1 |
| InChIKey | OVTQXBCQCDNWMJ-DOWYKABASA-N |
| XLogP | -1.80 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol?
The IUPAC name of (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol (CID 138717575) is (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol.
What is the SMILES notation for (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol?
The canonical SMILES for (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol is CC[C@H](O)C1O[C@@H](O)C(O)C1O.
What is the InChIKey of (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol?
The InChIKey is OVTQXBCQCDNWMJ-DOWYKABASA-N. The full InChI is InChI=1S/C7H14O5/c1-2-3(8)6-4(9)5(10)7(11)12-6/h3-11H,2H2,1H3/t3-,4?,5?,6?,7+/m0/s1.
What are the key properties of (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol?
(2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol has a molecular weight of 178.18 g/mol, XLogP of -1.80, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-[(1S)-1-hydroxypropyl]oxolane-2,3,4-triol is sourced from PubChem (CID 138717575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).