About 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione
2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione (PubChem CID 138717814) has the molecular formula C18H14N2O2
and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione.
Molecular Properties
| Compound Name | 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione |
| PubChem CID | 138717814 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione |
| SMILES | O=C1NC(=O)C2(N1)c1ccccc1-c1ccc(C3CC3)cc12 |
| InChI | InChI=1S/C18H14N2O2/c21-16-18(20-17(22)19-16)14-4-2-1-3-12(14)13-8-7-11(9-15(13)18)10-5-6-10/h1-4,7-10H,5-6H2,(H2,19,20,21,22) |
| InChIKey | YNIGFZOTWOVBHD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione?
The IUPAC name of 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione (CID 138717814) is 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione.
What is the SMILES notation for 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione?
The canonical SMILES for 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione is O=C1NC(=O)C2(N1)c1ccccc1-c1ccc(C3CC3)cc12.
What is the InChIKey of 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione?
The InChIKey is YNIGFZOTWOVBHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2/c21-16-18(20-17(22)19-16)14-4-2-1-3-12(14)13-8-7-11(9-15(13)18)10-5-6-10/h1-4,7-10H,5-6H2,(H2,19,20,21,22).
What are the key properties of 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione?
2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione has a molecular weight of 290.32 g/mol, XLogP of 2.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropylspiro[fluorene-9,5'-imidazolidine]-2',4'-dione is sourced from PubChem (CID 138717814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).