C17H23N — CID 138718078
(4bR)-9-ethyl-3,4,6-trimethyl-3,4,4b,8a-tetrahydrocarbazole (PubChem CID 138718078) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is (4bR)-9-ethyl-3,4,6-trimethyl-3,4,4b,8a-tetrahydrocarbazole.
| Compound Name | (4bR)-9-ethyl-3,4,6-trimethyl-3,4,4b,8a-tetrahydrocarbazole |
|---|---|
| PubChem CID | 138718078 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | (4bR)-9-ethyl-3,4,6-trimethyl-3,4,4b,8a-tetrahydrocarbazole |
| SMILES | CCN1C2=C(C(C)C(C)C=C2)[C@H]2C=C(C)C=CC21 |
| InChI | InChI=1S/C17H23N/c1-5-18-15-8-6-11(2)10-14(15)17-13(4)12(3)7-9-16(17)18/h6-10,12-15H,5H2,1-4H3/t12?,13?,14-,15?/m0/s1 |
| InChIKey | ZZZQXKVIJAVGPA-YFXXHVASSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |