About 2-ethyl-4,4a-dihydroquinazoline
2-ethyl-4,4a-dihydroquinazoline (PubChem CID 138718106) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-ethyl-4,4a-dihydroquinazoline.
Molecular Properties
| Compound Name | 2-ethyl-4,4a-dihydroquinazoline |
| PubChem CID | 138718106 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-ethyl-4,4a-dihydroquinazoline |
| SMILES | CCC1=NCC2C=CC=CC2=N1 |
| InChI | InChI=1S/C10H12N2/c1-2-10-11-7-8-5-3-4-6-9(8)12-10/h3-6,8H,2,7H2,1H3 |
| InChIKey | GNUCZYIYAGRAOT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4,4a-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,4a-dihydroquinazoline?
The IUPAC name of 2-ethyl-4,4a-dihydroquinazoline (CID 138718106) is 2-ethyl-4,4a-dihydroquinazoline.
What is the SMILES notation for 2-ethyl-4,4a-dihydroquinazoline?
The canonical SMILES for 2-ethyl-4,4a-dihydroquinazoline is CCC1=NCC2C=CC=CC2=N1.
What is the InChIKey of 2-ethyl-4,4a-dihydroquinazoline?
The InChIKey is GNUCZYIYAGRAOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-10-11-7-8-5-3-4-6-9(8)12-10/h3-6,8H,2,7H2,1H3.
What are the key properties of 2-ethyl-4,4a-dihydroquinazoline?
2-ethyl-4,4a-dihydroquinazoline has a molecular weight of 160.22 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,4a-dihydroquinazoline is sourced from PubChem (CID 138718106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).