About (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline
(4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline (PubChem CID 138718107) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline.
Molecular Properties
| Compound Name | (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline |
| PubChem CID | 138718107 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline |
| SMILES | CCC1=C(C)N=C2C=CC=C[C@@H]2C1C |
| InChI | InChI=1S/C13H17N/c1-4-11-9(2)12-7-5-6-8-13(12)14-10(11)3/h5-9,12H,4H2,1-3H3/t9?,12-/m1/s1 |
| InChIKey | UAVSLYCNBRHFPR-FFFFSGIJSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline?
The IUPAC name of (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline (CID 138718107) is (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline.
What is the SMILES notation for (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline?
The canonical SMILES for (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline is CCC1=C(C)N=C2C=CC=C[C@@H]2C1C.
What is the InChIKey of (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline?
The InChIKey is UAVSLYCNBRHFPR-FFFFSGIJSA-N. The full InChI is InChI=1S/C13H17N/c1-4-11-9(2)12-7-5-6-8-13(12)14-10(11)3/h5-9,12H,4H2,1-3H3/t9?,12-/m1/s1.
What are the key properties of (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline?
(4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline has a molecular weight of 187.29 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4aR)-3-ethyl-2,4-dimethyl-4,4a-dihydroquinoline is sourced from PubChem (CID 138718107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).