C26H37N3 — CID 138718125
9-[2-[(3Z,5Z)-cycloocta-3,5-dien-1-yl]ethyl]-7-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-methyl-3-methylidene-4,6,7,8-tetrahydropyrazino[1,2-a]pyrimidine (PubChem CID 138718125) has the molecular formula C26H37N3 and a molecular weight of 391.60 g/mol. Its IUPAC name is 9-[2-[(3Z,5Z)-cycloocta-3,5-dien-1-yl]ethyl]-7-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-methyl-3-methylidene-4,6,7,8-tetrahydropyrazino[1,2-a]pyrimidine.
| Compound Name | 9-[2-[(3Z,5Z)-cycloocta-3,5-dien-1-yl]ethyl]-7-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-methyl-3-methylidene-4,6,7,8-tetrahydropyrazino[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 138718125 |
| Molecular Formula | C26H37N3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.30 |
| IUPAC Name | 9-[2-[(3Z,5Z)-cycloocta-3,5-dien-1-yl]ethyl]-7-[(2Z,4E)-hepta-2,4-dien-4-yl]-2-methyl-3-methylidene-4,6,7,8-tetrahydropyrazino[1,2-a]pyrimidine |
| SMILES | C=C1CN2CC(C(/C=C\C)=C/CC)NC(CCC3C/C=C\C=C/CC3)=C2N=C1C |
| InChI | InChI=1S/C26H37N3/c1-5-12-23(13-6-2)25-19-29-18-20(3)21(4)27-26(29)24(28-25)17-16-22-14-10-8-7-9-11-15-22/h5,7-10,12-13,22,25,28H,3,6,11,14-19H2,1-2,4H3/b9-7-,10-8-,12-5-,23-13+ |
| InChIKey | LBZGGXXFZTUOEM-KUTMDDRWSA-N |
| XLogP | 6.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|