About (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol
(5S,6S)-6-(3-methylbutyl)oxane-2,5-diol (PubChem CID 138718245) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol.
Molecular Properties
| Compound Name | (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol |
| PubChem CID | 138718245 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol |
| SMILES | CC(C)CC[C@@H]1OC(O)CC[C@@H]1O |
| InChI | InChI=1S/C10H20O3/c1-7(2)3-5-9-8(11)4-6-10(12)13-9/h7-12H,3-6H2,1-2H3/t8-,9-,10?/m0/s1 |
| InChIKey | BNNMJACVJMRNAV-XMCUXHSSSA-N |
| XLogP | 1.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol?
The IUPAC name of (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol (CID 138718245) is (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol.
What is the SMILES notation for (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol?
The canonical SMILES for (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol is CC(C)CC[C@@H]1OC(O)CC[C@@H]1O.
What is the InChIKey of (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol?
The InChIKey is BNNMJACVJMRNAV-XMCUXHSSSA-N. The full InChI is InChI=1S/C10H20O3/c1-7(2)3-5-9-8(11)4-6-10(12)13-9/h7-12H,3-6H2,1-2H3/t8-,9-,10?/m0/s1.
What are the key properties of (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol?
(5S,6S)-6-(3-methylbutyl)oxane-2,5-diol has a molecular weight of 188.27 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6S)-6-(3-methylbutyl)oxane-2,5-diol is sourced from PubChem (CID 138718245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).