C23H23Cl2F2N3OS — CID 138718281
[3-[3-[(Z,3E)-6-amino-3-(aminomethylidene)-5-ethylhept-4-en-1-ynyl]-2,4-difluoroanilino]sulfanyl-2,5-dichlorophenyl]methanol (PubChem CID 138718281) has the molecular formula C23H23Cl2F2N3OS and a molecular weight of 498.43 g/mol. Its IUPAC name is [3-[3-[(Z,3E)-6-amino-3-(aminomethylidene)-5-ethylhept-4-en-1-ynyl]-2,4-difluoroanilino]sulfanyl-2,5-dichlorophenyl]methanol.
| Compound Name | [3-[3-[(Z,3E)-6-amino-3-(aminomethylidene)-5-ethylhept-4-en-1-ynyl]-2,4-difluoroanilino]sulfanyl-2,5-dichlorophenyl]methanol |
|---|---|
| PubChem CID | 138718281 |
| Molecular Formula | C23H23Cl2F2N3OS |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | [3-[3-[(Z,3E)-6-amino-3-(aminomethylidene)-5-ethylhept-4-en-1-ynyl]-2,4-difluoroanilino]sulfanyl-2,5-dichlorophenyl]methanol |
| SMILES | CC/C(=C/C(C#Cc1c(F)ccc(NSc2cc(Cl)cc(CO)c2Cl)c1F)=C\N)C(C)N |
| InChI | InChI=1S/C23H23Cl2F2N3OS/c1-3-15(13(2)29)8-14(11-28)4-5-18-19(26)6-7-20(23(18)27)30-32-21-10-17(24)9-16(12-31)22(21)25/h6-11,13,30-31H,3,12,28-29H2,1-2H3/b14-11+,15-8- |
| InChIKey | OYLOOSJNHQWYEP-REXKXQMVSA-N |
| XLogP | 5.76 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|