C17H21F2N3 — CID 138718286
3-[2-(5-amino-2,7-difluorocyclohepta-1,3-dien-1-yl)ethynyl]-5-ethyl-1-methyl-2H-pyridin-6-amine (PubChem CID 138718286) has the molecular formula C17H21F2N3 and a molecular weight of 305.37 g/mol. Its IUPAC name is 3-[2-(5-amino-2,7-difluorocyclohepta-1,3-dien-1-yl)ethynyl]-5-ethyl-1-methyl-2H-pyridin-6-amine.
| Compound Name | 3-[2-(5-amino-2,7-difluorocyclohepta-1,3-dien-1-yl)ethynyl]-5-ethyl-1-methyl-2H-pyridin-6-amine |
|---|---|
| PubChem CID | 138718286 |
| Molecular Formula | C17H21F2N3 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 3-[2-(5-amino-2,7-difluorocyclohepta-1,3-dien-1-yl)ethynyl]-5-ethyl-1-methyl-2H-pyridin-6-amine |
| SMILES | CCC1=C(N)N(C)CC(C#CC2=C(F)C=CC(N)CC2F)=C1 |
| InChI | InChI=1S/C17H21F2N3/c1-3-12-8-11(10-22(2)17(12)21)4-6-14-15(18)7-5-13(20)9-16(14)19/h5,7-8,13,16H,3,9-10,20-21H2,1-2H3 |
| InChIKey | AJMRXIXHADSJJJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|