C22H22Cl2F2N4OS — CID 138718323
3-[3-[(3Z,4Z)-6-amino-5-(aminomethyl)-3-(aminomethylidene)hepta-1,4-dienyl]-2,4-difluoroanilino]sulfanyl-2,5-dichlorobenzaldehyde (PubChem CID 138718323) has the molecular formula C22H22Cl2F2N4OS and a molecular weight of 499.41 g/mol. Its IUPAC name is 3-[3-[(3Z,4Z)-6-amino-5-(aminomethyl)-3-(aminomethylidene)hepta-1,4-dienyl]-2,4-difluoroanilino]sulfanyl-2,5-dichlorobenzaldehyde.
| Compound Name | 3-[3-[(3Z,4Z)-6-amino-5-(aminomethyl)-3-(aminomethylidene)hepta-1,4-dienyl]-2,4-difluoroanilino]sulfanyl-2,5-dichlorobenzaldehyde |
|---|---|
| PubChem CID | 138718323 |
| Molecular Formula | C22H22Cl2F2N4OS |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | 3-[3-[(3Z,4Z)-6-amino-5-(aminomethyl)-3-(aminomethylidene)hepta-1,4-dienyl]-2,4-difluoroanilino]sulfanyl-2,5-dichlorobenzaldehyde |
| SMILES | CC(N)/C(=C\C(C=Cc1c(F)ccc(NSc2cc(Cl)cc(C=O)c2Cl)c1F)=C/N)CN |
| InChI | InChI=1S/C22H22Cl2F2N4OS/c1-12(29)14(10-28)6-13(9-27)2-3-17-18(25)4-5-19(22(17)26)30-32-20-8-16(23)7-15(11-31)21(20)24/h2-9,11-12,30H,10,27-29H2,1H3/b3-2?,13-9-,14-6- |
| InChIKey | GOUAIFHZOSDOHZ-IRWBAYBDSA-N |
| XLogP | 5.29 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|