C15H17F2N3 — CID 138718348
3-[(4E,6E)-7-amino-4,8-difluoro-3-methylideneocta-4,6-dien-1-ynyl]-4-methyl-1,2-dihydropyridin-6-amine (PubChem CID 138718348) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[(4E,6E)-7-amino-4,8-difluoro-3-methylideneocta-4,6-dien-1-ynyl]-4-methyl-1,2-dihydropyridin-6-amine.
| Compound Name | 3-[(4E,6E)-7-amino-4,8-difluoro-3-methylideneocta-4,6-dien-1-ynyl]-4-methyl-1,2-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 138718348 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-[(4E,6E)-7-amino-4,8-difluoro-3-methylideneocta-4,6-dien-1-ynyl]-4-methyl-1,2-dihydropyridin-6-amine |
| SMILES | C=C(C#CC1=C(C)C=C(N)NC1)/C(F)=C\C=C(\N)CF |
| InChI | InChI=1S/C15H17F2N3/c1-10(14(17)6-5-13(18)8-16)3-4-12-9-20-15(19)7-11(12)2/h5-7,20H,1,8-9,18-19H2,2H3/b13-5+,14-6+ |
| InChIKey | WVMSMMZJJZVONE-ACFHMISVSA-N |
| XLogP | 1.93 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|