About 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione
8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione (PubChem CID 138718431) has the molecular formula C9H13NO2S2
and a molecular weight of 231.34 g/mol. Its IUPAC name is 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione.
Molecular Properties
| Compound Name | 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione |
| PubChem CID | 138718431 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione |
| SMILES | CC1CS(=O)(=O)C2(CC=CC2)C(=S)N1 |
| InChI | InChI=1S/C9H13NO2S2/c1-7-6-14(11,12)9(8(13)10-7)4-2-3-5-9/h2-3,7H,4-6H2,1H3,(H,10,13) |
| InChIKey | TVEZYWHKOHTQRY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione?
The IUPAC name of 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione (CID 138718431) is 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione.
What is the SMILES notation for 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione?
The canonical SMILES for 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione is CC1CS(=O)(=O)C2(CC=CC2)C(=S)N1.
What is the InChIKey of 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione?
The InChIKey is TVEZYWHKOHTQRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S2/c1-7-6-14(11,12)9(8(13)10-7)4-2-3-5-9/h2-3,7H,4-6H2,1H3,(H,10,13).
What are the key properties of 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione?
8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione has a molecular weight of 231.34 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-6,6-dioxo-6λ6-thia-9-azaspiro[4.5]dec-2-ene-10-thione is sourced from PubChem (CID 138718431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).