C15H23N — CID 138718519
(2Z,4Z,6Z)-N-ethyl-3-methyl-2-propylidenenona-4,6,8-trien-1-imine (PubChem CID 138718519) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (2Z,4Z,6Z)-N-ethyl-3-methyl-2-propylidenenona-4,6,8-trien-1-imine.
| Compound Name | (2Z,4Z,6Z)-N-ethyl-3-methyl-2-propylidenenona-4,6,8-trien-1-imine |
|---|---|
| PubChem CID | 138718519 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (2Z,4Z,6Z)-N-ethyl-3-methyl-2-propylidenenona-4,6,8-trien-1-imine |
| SMILES | C=C/C=C\C=C/C(C)C(=C/CC)/C=N/CC |
| InChI | InChI=1S/C15H23N/c1-5-8-9-10-12-14(4)15(11-6-2)13-16-7-3/h5,8-14H,1,6-7H2,2-4H3/b9-8-,12-10-,15-11+,16-13+ |
| InChIKey | SCWPDYXDTWYRLZ-LBHXXQSUSA-N |
| XLogP | 4.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|