C16H21N7O3 — CID 138719042
N-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-2-[[2-(diaminomethylideneamino)acetyl]amino]-N-methylacetamide (PubChem CID 138719042) has the molecular formula C16H21N7O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is N-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-2-[[2-(diaminomethylideneamino)acetyl]amino]-N-methylacetamide.
| Compound Name | N-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-2-[[2-(diaminomethylideneamino)acetyl]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 138719042 |
| Molecular Formula | C16H21N7O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[(3-benzyl-1,2,4-oxadiazol-5-yl)methyl]-2-[[2-(diaminomethylideneamino)acetyl]amino]-N-methylacetamide |
| SMILES | CN(Cc1nc(Cc2ccccc2)no1)C(=O)CNC(=O)CN=C(N)N |
| InChI | InChI=1S/C16H21N7O3/c1-23(15(25)9-19-13(24)8-20-16(17)18)10-14-21-12(22-26-14)7-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3,(H,19,24)(H4,17,18,20) |
| InChIKey | PKOPUQYCXZHFQS-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 152.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|