About 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine
4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine (PubChem CID 138719097) has the molecular formula C13H6BrClN4S
and a molecular weight of 365.64 g/mol. Its IUPAC name is 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine |
| PubChem CID | 138719097 |
| Molecular Formula | C13H6BrClN4S |
| Molecular Weight | 365.64 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine |
| SMILES | Clc1nc(-c2c[nH]c3cnc(Br)cc23)c2sccc2n1 |
| InChI | InChI=1S/C13H6BrClN4S/c14-10-3-6-7(4-16-9(6)5-17-10)11-12-8(1-2-20-12)18-13(15)19-11/h1-5,16H |
| InChIKey | IDSDFVJTAXXYEN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.64 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine?
The IUPAC name of 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine (CID 138719097) is 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine.
What is the SMILES notation for 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine?
The canonical SMILES for 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine is Clc1nc(-c2c[nH]c3cnc(Br)cc23)c2sccc2n1.
What is the InChIKey of 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine?
The InChIKey is IDSDFVJTAXXYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6BrClN4S/c14-10-3-6-7(4-16-9(6)5-17-10)11-12-8(1-2-20-12)18-13(15)19-11/h1-5,16H.
What are the key properties of 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine?
4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine has a molecular weight of 365.64 g/mol, XLogP of 4.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-1H-pyrrolo[2,3-c]pyridin-3-yl)-2-chlorothieno[3,2-d]pyrimidine is sourced from PubChem (CID 138719097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).