C7H12FIN2 — CID 138719478
3a-fluoro-2-iodo-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine (PubChem CID 138719478) has the molecular formula C7H12FIN2 and a molecular weight of 270.09 g/mol. Its IUPAC name is 3a-fluoro-2-iodo-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine.
| Compound Name | 3a-fluoro-2-iodo-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 138719478 |
| Molecular Formula | C7H12FIN2 |
| Molecular Weight | 270.09 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 3a-fluoro-2-iodo-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
| SMILES | NC1CC2CN(I)CC2(F)C1 |
| InChI | InChI=1S/C7H12FIN2/c8-7-2-6(10)1-5(7)3-11(9)4-7/h5-6H,1-4,10H2 |
| InChIKey | YQZDPMSDLPJPSS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.09 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|