C8H16N2S — CID 138719481
N,5-dimethyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine (PubChem CID 138719481) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is N,5-dimethyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine.
| Compound Name | N,5-dimethyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
|---|---|
| PubChem CID | 138719481 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | N,5-dimethyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-3-amine |
| SMILES | CNC1CSC2CN(C)CC12 |
| InChI | InChI=1S/C8H16N2S/c1-9-7-5-11-8-4-10(2)3-6(7)8/h6-9H,3-5H2,1-2H3 |
| InChIKey | FGOBSRWCZSQJAX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |