About N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide
N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide (PubChem CID 138719539) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide.
Molecular Properties
| Compound Name | N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide |
| PubChem CID | 138719539 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide |
| SMILES | CC/C=C(/N=C(/N)CCC)C(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-6-8-10(12(3,4)5)14-11(13)9-7-2/h8H,6-7,9H2,1-5H3,(H2,13,14)/b10-8+ |
| InChIKey | BQWFIEGGFCWYFH-CSKARUKUSA-N |
| XLogP | 3.48 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide?
The IUPAC name of N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide (CID 138719539) is N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide.
What is the SMILES notation for N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide?
The canonical SMILES for N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide is CC/C=C(/N=C(/N)CCC)C(C)(C)C.
What is the InChIKey of N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide?
The InChIKey is BQWFIEGGFCWYFH-CSKARUKUSA-N. The full InChI is InChI=1S/C12H24N2/c1-6-8-10(12(3,4)5)14-11(13)9-7-2/h8H,6-7,9H2,1-5H3,(H2,13,14)/b10-8+.
What are the key properties of N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide?
N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide has a molecular weight of 196.34 g/mol, XLogP of 3.48, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-2,2-dimethylhex-3-en-3-yl]butanimidamide is sourced from PubChem (CID 138719539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).