C15H21NO2 — CID 138719986
(1Z,7Z)-5-(1-iminopentan-3-yl)-4-methylidenecycloocta-1,7-diene-1-carboxylic acid (PubChem CID 138719986) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (1Z,7Z)-5-(1-iminopentan-3-yl)-4-methylidenecycloocta-1,7-diene-1-carboxylic acid.
| Compound Name | (1Z,7Z)-5-(1-iminopentan-3-yl)-4-methylidenecycloocta-1,7-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 138719986 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (1Z,7Z)-5-(1-iminopentan-3-yl)-4-methylidenecycloocta-1,7-diene-1-carboxylic acid |
| SMILES | [H]/N=C/CC(CC)C1C/C=C\C(C(=O)O)=C/CC1=C |
| InChI | InChI=1S/C15H21NO2/c1-3-12(9-10-16)14-6-4-5-13(15(17)18)8-7-11(14)2/h4-5,8,10,12,14,16H,2-3,6-7,9H2,1H3,(H,17,18)/b5-4-,13-8+,16-10+ |
| InChIKey | BMFHCXKAXQWHDL-PPZNOTIGSA-N |
| XLogP | 3.59 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|